C27H24N2O3 — CID 90133284
3-[4-[(1S)-1-(1H-indazol-4-yl)-2-phenylethoxy]phenyl]hex-4-ynoic acid (PubChem CID 90133284) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[4-[(1S)-1-(1H-indazol-4-yl)-2-phenylethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(1S)-1-(1H-indazol-4-yl)-2-phenylethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90133284 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-[4-[(1S)-1-(1H-indazol-4-yl)-2-phenylethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(O[C@@H](Cc2ccccc2)c2cccc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C27H24N2O3/c1-2-7-21(17-27(30)31)20-12-14-22(15-13-20)32-26(16-19-8-4-3-5-9-19)23-10-6-11-25-24(23)18-28-29-25/h3-6,8-15,18,21,26H,16-17H2,1H3,(H,28,29)(H,30,31)/t21?,26-/m0/s1 |
| InChIKey | XSMGMFPYLLNHBD-UQTORGHUSA-N |
| XLogP | 5.51 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|