C28H26N2O3 — CID 90132936
3-[4-[(1S)-1-(1H-indazol-5-yl)-3-phenylpropoxy]phenyl]hex-4-ynoic acid (PubChem CID 90132936) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[4-[(1S)-1-(1H-indazol-5-yl)-3-phenylpropoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(1S)-1-(1H-indazol-5-yl)-3-phenylpropoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90132936 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-[4-[(1S)-1-(1H-indazol-5-yl)-3-phenylpropoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(O[C@@H](CCc2ccccc2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C28H26N2O3/c1-2-6-22(18-28(31)32)21-10-13-25(14-11-21)33-27(16-9-20-7-4-3-5-8-20)23-12-15-26-24(17-23)19-29-30-26/h3-5,7-8,10-15,17,19,22,27H,9,16,18H2,1H3,(H,29,30)(H,31,32)/t22?,27-/m0/s1 |
| InChIKey | LUPLDCJOPKNWTE-ZUILJJEPSA-N |
| XLogP | 5.90 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|