C25H22N4O3 — CID 142768712
(3S)-3-[4-[(1S)-1-(1H-indazol-6-yl)-2-pyrimidin-4-ylethoxy]phenyl]hex-4-ynoic acid (PubChem CID 142768712) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is (3S)-3-[4-[(1S)-1-(1H-indazol-6-yl)-2-pyrimidin-4-ylethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[(1S)-1-(1H-indazol-6-yl)-2-pyrimidin-4-ylethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 142768712 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (3S)-3-[4-[(1S)-1-(1H-indazol-6-yl)-2-pyrimidin-4-ylethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(O[C@@H](Cc2ccncn2)c2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C25H22N4O3/c1-2-3-18(13-25(30)31)17-6-8-22(9-7-17)32-24(14-21-10-11-26-16-27-21)19-4-5-20-15-28-29-23(20)12-19/h4-12,15-16,18,24H,13-14H2,1H3,(H,28,29)(H,30,31)/t18-,24-/m0/s1 |
| InChIKey | DSHZEEJYIIAZAH-UUOWRZLLSA-N |
| XLogP | 4.30 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|