C29H28N2O3 — CID 90133116
3-[4-[1-(7-methyl-1H-indol-6-yl)-2-(6-methyl-3-pyridinyl)ethoxy]phenyl]hex-4-ynoic acid (PubChem CID 90133116) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-[4-[1-(7-methyl-1H-indol-6-yl)-2-(6-methyl-3-pyridinyl)ethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[1-(7-methyl-1H-indol-6-yl)-2-(6-methyl-3-pyridinyl)ethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90133116 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[4-[1-(7-methyl-1H-indol-6-yl)-2-(6-methyl-3-pyridinyl)ethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OC(Cc2ccc(C)nc2)c2ccc3cc[nH]c3c2C)cc1 |
| InChI | InChI=1S/C29H28N2O3/c1-4-5-24(17-28(32)33)22-8-11-25(12-9-22)34-27(16-21-7-6-19(2)31-18-21)26-13-10-23-14-15-30-29(23)20(26)3/h6-15,18,24,27,30H,16-17H2,1-3H3,(H,32,33) |
| InChIKey | BJXVWYDOICXLDU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|