C30H29NO4 — CID 90133167
3-[4-[2-(4-methoxyphenyl)-1-(7-methyl-1H-indol-6-yl)ethoxy]phenyl]hex-4-ynoic acid (PubChem CID 90133167) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[4-[2-(4-methoxyphenyl)-1-(7-methyl-1H-indol-6-yl)ethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[2-(4-methoxyphenyl)-1-(7-methyl-1H-indol-6-yl)ethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90133167 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[4-[2-(4-methoxyphenyl)-1-(7-methyl-1H-indol-6-yl)ethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OC(Cc2ccc(OC)cc2)c2ccc3cc[nH]c3c2C)cc1 |
| InChI | InChI=1S/C30H29NO4/c1-4-5-24(19-29(32)33)22-8-13-26(14-9-22)35-28(18-21-6-11-25(34-3)12-7-21)27-15-10-23-16-17-31-30(23)20(27)2/h6-17,24,28,31H,18-19H2,1-3H3,(H,32,33) |
| InChIKey | KSTJPDBGMFMOQD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|