C26H23N3O3 — CID 142768717
(3S)-3-[4-[(1S)-1-(1H-indazol-5-yl)-2-pyridin-2-ylethoxy]phenyl]hex-4-ynoic acid (PubChem CID 142768717) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is (3S)-3-[4-[(1S)-1-(1H-indazol-5-yl)-2-pyridin-2-ylethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[(1S)-1-(1H-indazol-5-yl)-2-pyridin-2-ylethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 142768717 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (3S)-3-[4-[(1S)-1-(1H-indazol-5-yl)-2-pyridin-2-ylethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(O[C@@H](Cc2ccccn2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C26H23N3O3/c1-2-5-19(15-26(30)31)18-7-10-23(11-8-18)32-25(16-22-6-3-4-13-27-22)20-9-12-24-21(14-20)17-28-29-24/h3-4,6-14,17,19,25H,15-16H2,1H3,(H,28,29)(H,30,31)/t19-,25-/m0/s1 |
| InChIKey | GVIITMMXLYHLPB-DFBJGRDBSA-N |
| XLogP | 4.90 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|