C16H10F6N2O2 — CID 162582582
1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,3,6-trifluorophenoxy)propan-2-ol (PubChem CID 162582582) has the molecular formula C16H10F6N2O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,3,6-trifluorophenoxy)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,3,6-trifluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 162582582 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1,1,1-trifluoro-2-(1H-indazol-5-yl)-3-(2,3,6-trifluorophenoxy)propan-2-ol |
| SMILES | OC(COc1c(F)ccc(F)c1F)(c1ccc2[nH]ncc2c1)C(F)(F)F |
| InChI | InChI=1S/C16H10F6N2O2/c17-10-2-3-11(18)14(13(10)19)26-7-15(25,16(20,21)22)9-1-4-12-8(5-9)6-23-24-12/h1-6,25H,7H2,(H,23,24) |
| InChIKey | BSRLQVGQKGBNIF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|