C22H19F3O2 — CID 162584512
5-methyl-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 162584512) has the molecular formula C22H19F3O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-methyl-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 5-methyl-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 162584512 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-methyl-4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1CC(C=O)=CC=C1OCc1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H19F3O2/c1-15-11-16(13-26)5-10-21(15)27-14-17-3-2-4-19(12-17)18-6-8-20(9-7-18)22(23,24)25/h2-10,12-13,15H,11,14H2,1H3 |
| InChIKey | ZVMLIYVJNDNTKU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|