C11H7F4O3+ — CID 162584883
[(Z)-4-carboxy-1,1,1-trifluoro-3-(4-fluorophenyl)but-3-en-2-ylidene]oxidanium (PubChem CID 162584883) has the molecular formula C11H7F4O3+ and a molecular weight of 263.17 g/mol. Its IUPAC name is [(Z)-4-carboxy-1,1,1-trifluoro-3-(4-fluorophenyl)but-3-en-2-ylidene]oxidanium.
| Compound Name | [(Z)-4-carboxy-1,1,1-trifluoro-3-(4-fluorophenyl)but-3-en-2-ylidene]oxidanium |
|---|---|
| PubChem CID | 162584883 |
| Molecular Formula | C11H7F4O3+ |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | [(Z)-4-carboxy-1,1,1-trifluoro-3-(4-fluorophenyl)but-3-en-2-ylidene]oxidanium |
| SMILES | [H]/[O+]=C(C(=C\C(=O)O)/c1ccc(F)cc1)\C(F)(F)F |
| InChI | InChI=1S/C11H6F4O3/c12-7-3-1-6(2-4-7)8(5-9(16)17)10(18)11(13,14)15/h1-5H,(H,16,17)/p+1/b8-5- |
| InChIKey | RJTAWTVREYSGCG-YVMONPNESA-O |
| XLogP | 2.40 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|