C12H10F4OS2 — CID 163213333
1-(4-fluorophenyl)-3,3-bis(methylsulfanyl)-2-(trifluoromethyl)prop-2-en-1-one (PubChem CID 163213333) has the molecular formula C12H10F4OS2 and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,3-bis(methylsulfanyl)-2-(trifluoromethyl)prop-2-en-1-one.
| Compound Name | 1-(4-fluorophenyl)-3,3-bis(methylsulfanyl)-2-(trifluoromethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163213333 |
| Molecular Formula | C12H10F4OS2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-(4-fluorophenyl)-3,3-bis(methylsulfanyl)-2-(trifluoromethyl)prop-2-en-1-one |
| SMILES | CSC(SC)=C(C(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H10F4OS2/c1-18-11(19-2)9(12(14,15)16)10(17)7-3-5-8(13)6-4-7/h3-6H,1-2H3 |
| InChIKey | LKNOBMXXVUQSCD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|