C20H16F4N4O4S — CID 162589945
[1-[2-fluoro-4-(methylamino)phenyl]-7-methoxy-3-methylpyrazolo[3,4-c]quinolin-8-yl] trifluoromethanesulfonate (PubChem CID 162589945) has the molecular formula C20H16F4N4O4S and a molecular weight of 484.43 g/mol. Its IUPAC name is [1-[2-fluoro-4-(methylamino)phenyl]-7-methoxy-3-methylpyrazolo[3,4-c]quinolin-8-yl] trifluoromethanesulfonate.
| Compound Name | [1-[2-fluoro-4-(methylamino)phenyl]-7-methoxy-3-methylpyrazolo[3,4-c]quinolin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162589945 |
| Molecular Formula | C20H16F4N4O4S |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [1-[2-fluoro-4-(methylamino)phenyl]-7-methoxy-3-methylpyrazolo[3,4-c]quinolin-8-yl] trifluoromethanesulfonate |
| SMILES | CNc1ccc(-c2nn(C)c3cnc4cc(OC)c(OS(=O)(=O)C(F)(F)F)cc4c23)c(F)c1 |
| InChI | InChI=1S/C20H16F4N4O4S/c1-25-10-4-5-11(13(21)6-10)19-18-12-7-17(32-33(29,30)20(22,23)24)16(31-3)8-14(12)26-9-15(18)28(2)27-19/h4-9,25H,1-3H3 |
| InChIKey | AMYBDUUUGUEONL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|