C23H17F3N4O5S — CID 87538326
[4-(N-benzamidoanilino)-6-methoxyquinazolin-7-yl] trifluoromethanesulfonate (PubChem CID 87538326) has the molecular formula C23H17F3N4O5S and a molecular weight of 518.47 g/mol. Its IUPAC name is [4-(N-benzamidoanilino)-6-methoxyquinazolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-benzamidoanilino)-6-methoxyquinazolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87538326 |
| Molecular Formula | C23H17F3N4O5S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | [4-(N-benzamidoanilino)-6-methoxyquinazolin-7-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c(N(NC(=O)c3ccccc3)c3ccccc3)ncnc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H17F3N4O5S/c1-34-19-12-17-18(13-20(19)35-36(32,33)23(24,25)26)27-14-28-21(17)30(16-10-6-3-7-11-16)29-22(31)15-8-4-2-5-9-15/h2-14H,1H3,(H,29,31) |
| InChIKey | IBPGMTFIMHXBCD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|