C8H16F3N3 — CID 162594738
N-[(3R)-3-aminobutan-2-yl]-N'-ethyl-2,2,2-trifluoroethanimidamide (PubChem CID 162594738) has the molecular formula C8H16F3N3 and a molecular weight of 211.23 g/mol. Its IUPAC name is N-[(3R)-3-aminobutan-2-yl]-N'-ethyl-2,2,2-trifluoroethanimidamide.
| Compound Name | N-[(3R)-3-aminobutan-2-yl]-N'-ethyl-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 162594738 |
| Molecular Formula | C8H16F3N3 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-[(3R)-3-aminobutan-2-yl]-N'-ethyl-2,2,2-trifluoroethanimidamide |
| SMILES | CC/N=C(\NC(C)[C@@H](C)N)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N3/c1-4-13-7(8(9,10)11)14-6(3)5(2)12/h5-6H,4,12H2,1-3H3,(H,13,14)/t5-,6?/m1/s1 |
| InChIKey | AGKZAMLNQNMGHH-LWOQYNTDSA-N |
| XLogP | 1.29 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|