C5H12N2S2 — CID 130787867
[(2R,3R)-3-aminobutan-2-yl]carbamodithioic acid (PubChem CID 130787867) has the molecular formula C5H12N2S2 and a molecular weight of 164.30 g/mol. Its IUPAC name is [(2R,3R)-3-aminobutan-2-yl]carbamodithioic acid.
| Compound Name | [(2R,3R)-3-aminobutan-2-yl]carbamodithioic acid |
|---|---|
| PubChem CID | 130787867 |
| Molecular Formula | C5H12N2S2 |
| Molecular Weight | 164.30 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | [(2R,3R)-3-aminobutan-2-yl]carbamodithioic acid |
| SMILES | C[C@@H](N)[C@@H](C)NC(=S)S |
| InChI | InChI=1S/C5H12N2S2/c1-3(6)4(2)7-5(8)9/h3-4H,6H2,1-2H3,(H2,7,8,9)/t3-,4-/m1/s1 |
| InChIKey | NBEYQCBCDXOERR-QWWZWVQMSA-N |
| XLogP | 0.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|