C25H21F3N4O4 — CID 162597775
8-(2-amino-4-oxopent-2-en-3-yl)-9-methoxy-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazino[2,3-c]quinolin-2-one (PubChem CID 162597775) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 8-(2-amino-4-oxopent-2-en-3-yl)-9-methoxy-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazino[2,3-c]quinolin-2-one.
| Compound Name | 8-(2-amino-4-oxopent-2-en-3-yl)-9-methoxy-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazino[2,3-c]quinolin-2-one |
|---|---|
| PubChem CID | 162597775 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 8-(2-amino-4-oxopent-2-en-3-yl)-9-methoxy-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazino[2,3-c]quinolin-2-one |
| SMILES | COc1cc2c(cc1C(C(C)=O)=C(C)N)ncc1ncc(=O)n(Cc3ccc(OC(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C25H21F3N4O4/c1-13(29)23(14(2)33)18-8-19-17(9-21(18)35-3)24-20(10-30-19)31-11-22(34)32(24)12-15-4-6-16(7-5-15)36-25(26,27)28/h4-11H,12,29H2,1-3H3 |
| InChIKey | HXQNLBVLNHYWGV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|