C15H12F3N3O2 — CID 162597912
4-[[4-(2-hydroxyacetyl)-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzonitrile (PubChem CID 162597912) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyacetyl)-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2-hydroxyacetyl)-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 162597912 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[[4-(2-hydroxyacetyl)-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(C(=O)CO)c(C(F)(F)F)nn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H12F3N3O2/c1-9-13(12(23)8-22)14(15(16,17)18)20-21(9)7-11-4-2-10(6-19)3-5-11/h2-5,22H,7-8H2,1H3 |
| InChIKey | FPJWUIIIHZRFLE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |