C14H11F3N4O2 — CID 118171214
2-[4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]acetonitrile (PubChem CID 118171214) has the molecular formula C14H11F3N4O2 and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-[4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]acetonitrile.
| Compound Name | 2-[4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 118171214 |
| Molecular Formula | C14H11F3N4O2 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]acetonitrile |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1Cc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C14H11F3N4O2/c1-9-12(21(22)23)13(14(15,16)17)19-20(9)8-11-4-2-10(3-5-11)6-7-18/h2-5H,6,8H2,1H3 |
| InChIKey | VJOSCBPIPREYSH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|