C12H8F3N5O5 — CID 174815998
nitroso 4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]pyridine-3-carboxylate (PubChem CID 174815998) has the molecular formula C12H8F3N5O5 and a molecular weight of 359.22 g/mol. Its IUPAC name is nitroso 4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]pyridine-3-carboxylate.
| Compound Name | nitroso 4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 174815998 |
| Molecular Formula | C12H8F3N5O5 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | nitroso 4-[[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]methyl]pyridine-3-carboxylate |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1Cc1ccncc1C(=O)ON=O |
| InChI | InChI=1S/C12H8F3N5O5/c1-6-9(20(23)24)10(12(13,14)15)17-19(6)5-7-2-3-16-4-8(7)11(21)25-18-22/h2-4H,5H2,1H3 |
| InChIKey | WAKBWIYWNDMBLM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 129.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|