C16H19N5O2 — CID 145209201
tert-butyl N-[1-[(4-cyanophenyl)methyl]-5-methyltriazol-4-yl]carbamate (PubChem CID 145209201) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-cyanophenyl)methyl]-5-methyltriazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-cyanophenyl)methyl]-5-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 145209201 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl N-[1-[(4-cyanophenyl)methyl]-5-methyltriazol-4-yl]carbamate |
| SMILES | Cc1c(NC(=O)OC(C)(C)C)nnn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H19N5O2/c1-11-14(18-15(22)23-16(2,3)4)19-20-21(11)10-13-7-5-12(9-17)6-8-13/h5-8H,10H2,1-4H3,(H,18,22) |
| InChIKey | MGLHKCUEMDVXFK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |