C26H31N5O4S — CID 177260582
3-[4-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-propylsulfanylbenzotriazol-1-yl]methyl]phenyl]prop-2-ynoic acid (PubChem CID 177260582) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is 3-[4-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-propylsulfanylbenzotriazol-1-yl]methyl]phenyl]prop-2-ynoic acid.
| Compound Name | 3-[4-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-propylsulfanylbenzotriazol-1-yl]methyl]phenyl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 177260582 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3-[4-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-propylsulfanylbenzotriazol-1-yl]methyl]phenyl]prop-2-ynoic acid |
| SMILES | CCCSc1cc(NCCNC(=O)OC(C)(C)C)c2nnn(Cc3ccc(C#CC(=O)O)cc3)c2c1 |
| InChI | InChI=1S/C26H31N5O4S/c1-5-14-36-20-15-21(27-12-13-28-25(34)35-26(2,3)4)24-22(16-20)31(30-29-24)17-19-8-6-18(7-9-19)10-11-23(32)33/h6-9,15-16,27H,5,12-14,17H2,1-4H3,(H,28,34)(H,32,33) |
| InChIKey | OCWBKVDXYQLOTE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|