C23H31N7O2S — CID 168959958
tert-butyl N-[2-[[3-[(4-ethynylphenyl)methyl]-5-propylsulfanyl-3a,6-dihydro-2H-triazolo[4,5-d]pyrimidin-7-ylidene]amino]ethyl]carbamate (PubChem CID 168959958) has the molecular formula C23H31N7O2S and a molecular weight of 469.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[(4-ethynylphenyl)methyl]-5-propylsulfanyl-3a,6-dihydro-2H-triazolo[4,5-d]pyrimidin-7-ylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[(4-ethynylphenyl)methyl]-5-propylsulfanyl-3a,6-dihydro-2H-triazolo[4,5-d]pyrimidin-7-ylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 168959958 |
| Molecular Formula | C23H31N7O2S |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | tert-butyl N-[2-[[3-[(4-ethynylphenyl)methyl]-5-propylsulfanyl-3a,6-dihydro-2H-triazolo[4,5-d]pyrimidin-7-ylidene]amino]ethyl]carbamate |
| SMILES | C#Cc1ccc(CN2NN=C3/C(=N/CCNC(=O)OC(C)(C)C)NC(SCCC)=NC32)cc1 |
| InChI | InChI=1S/C23H31N7O2S/c1-6-14-33-21-26-19(24-12-13-25-22(31)32-23(3,4)5)18-20(27-21)30(29-28-18)15-17-10-8-16(7-2)9-11-17/h2,8-11,20,29H,6,12-15H2,1,3-5H3,(H,25,31)(H,24,26,27) |
| InChIKey | CPRXHOASVVAIPM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|