C22H27N7O2S — CID 168958905
tert-butyl N-[2-[[3-[(4-methylphenyl)methyl]-5-prop-2-ynylsulfanyltriazolo[4,5-d]pyrimidin-7-yl]amino]ethyl]carbamate (PubChem CID 168958905) has the molecular formula C22H27N7O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[(4-methylphenyl)methyl]-5-prop-2-ynylsulfanyltriazolo[4,5-d]pyrimidin-7-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[(4-methylphenyl)methyl]-5-prop-2-ynylsulfanyltriazolo[4,5-d]pyrimidin-7-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 168958905 |
| Molecular Formula | C22H27N7O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | tert-butyl N-[2-[[3-[(4-methylphenyl)methyl]-5-prop-2-ynylsulfanyltriazolo[4,5-d]pyrimidin-7-yl]amino]ethyl]carbamate |
| SMILES | C#CCSc1nc(NCCNC(=O)OC(C)(C)C)c2nnn(Cc3ccc(C)cc3)c2n1 |
| InChI | InChI=1S/C22H27N7O2S/c1-6-13-32-20-25-18(23-11-12-24-21(30)31-22(3,4)5)17-19(26-20)29(28-27-17)14-16-9-7-15(2)8-10-16/h1,7-10H,11-14H2,2-5H3,(H,24,30)(H,23,25,26) |
| InChIKey | YNFDSWVODLMSFY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|