C20H27N7O4S2 — CID 156539145
tert-butyl N-[2-[1-methyl-4-[(4-sulfamoylphenyl)methylamino]pyrazolo[3,4-d]pyrimidin-6-yl]sulfanylethyl]carbamate (PubChem CID 156539145) has the molecular formula C20H27N7O4S2 and a molecular weight of 493.62 g/mol. Its IUPAC name is tert-butyl N-[2-[1-methyl-4-[(4-sulfamoylphenyl)methylamino]pyrazolo[3,4-d]pyrimidin-6-yl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-methyl-4-[(4-sulfamoylphenyl)methylamino]pyrazolo[3,4-d]pyrimidin-6-yl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 156539145 |
| Molecular Formula | C20H27N7O4S2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | tert-butyl N-[2-[1-methyl-4-[(4-sulfamoylphenyl)methylamino]pyrazolo[3,4-d]pyrimidin-6-yl]sulfanylethyl]carbamate |
| SMILES | Cn1ncc2c(NCc3ccc(S(N)(=O)=O)cc3)nc(SCCNC(=O)OC(C)(C)C)nc21 |
| InChI | InChI=1S/C20H27N7O4S2/c1-20(2,3)31-19(28)22-9-10-32-18-25-16(15-12-24-27(4)17(15)26-18)23-11-13-5-7-14(8-6-13)33(21,29)30/h5-8,12H,9-11H2,1-4H3,(H,22,28)(H2,21,29,30)(H,23,25,26) |
| InChIKey | WGOWUPVTDHYIBS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 154.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|