C15H18ClN5O2 — CID 20824100
tert-butyl N-[2-[(5-chloro-6-ethynylimidazo[1,2-a]pyrazin-8-yl)amino]ethyl]carbamate (PubChem CID 20824100) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-chloro-6-ethynylimidazo[1,2-a]pyrazin-8-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-chloro-6-ethynylimidazo[1,2-a]pyrazin-8-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 20824100 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | tert-butyl N-[2-[(5-chloro-6-ethynylimidazo[1,2-a]pyrazin-8-yl)amino]ethyl]carbamate |
| SMILES | C#Cc1nc(NCCNC(=O)OC(C)(C)C)c2nccn2c1Cl |
| InChI | InChI=1S/C15H18ClN5O2/c1-5-10-11(16)21-9-8-18-13(21)12(20-10)17-6-7-19-14(22)23-15(2,3)4/h1,8-9H,6-7H2,2-4H3,(H,17,20)(H,19,22) |
| InChIKey | ABFQXKFDLYSUDP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|