C19H28ClN5O2Si — CID 20824102
tert-butyl N-[2-[[5-chloro-3-methyl-6-(2-trimethylsilylethynyl)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]carbamate (PubChem CID 20824102) has the molecular formula C19H28ClN5O2Si and a molecular weight of 422.01 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-chloro-3-methyl-6-(2-trimethylsilylethynyl)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-chloro-3-methyl-6-(2-trimethylsilylethynyl)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 20824102 |
| Molecular Formula | C19H28ClN5O2Si |
| Molecular Weight | 422.01 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | tert-butyl N-[2-[[5-chloro-3-methyl-6-(2-trimethylsilylethynyl)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]carbamate |
| SMILES | Cc1cnc2c(NCCNC(=O)OC(C)(C)C)nc(C#C[Si](C)(C)C)c(Cl)n12 |
| InChI | InChI=1S/C19H28ClN5O2Si/c1-13-12-23-17-16(21-9-10-22-18(26)27-19(2,3)4)24-14(15(20)25(13)17)8-11-28(5,6)7/h12H,9-10H2,1-7H3,(H,21,24)(H,22,26) |
| InChIKey | UASJKHUHFMYTHH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.01 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|