C17H22N6O3 — CID 135255289
tert-butyl N-[(1S)-2-(4-cyanophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamate (PubChem CID 135255289) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-(4-cyanophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-(4-cyanophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 135255289 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | tert-butyl N-[(1S)-2-(4-cyanophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(C#N)cc1)c1nnn(CCO)n1 |
| InChI | InChI=1S/C17H22N6O3/c1-17(2,3)26-16(25)19-14(15-20-22-23(21-15)8-9-24)10-12-4-6-13(11-18)7-5-12/h4-7,14,24H,8-10H2,1-3H3,(H,19,25)/t14-/m0/s1 |
| InChIKey | BZCWEHJSPRBQOR-AWEZNQCLSA-N |
| XLogP | 1.35 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |