C17H25N5O4 — CID 175114027
tert-butyl N-[1-[2-(2-hydroxyethyl)tetrazol-5-yl]-2-(4-methoxyphenyl)ethyl]carbamate (PubChem CID 175114027) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-hydroxyethyl)tetrazol-5-yl]-2-(4-methoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-hydroxyethyl)tetrazol-5-yl]-2-(4-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 175114027 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | tert-butyl N-[1-[2-(2-hydroxyethyl)tetrazol-5-yl]-2-(4-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1ccc(CC(NC(=O)OC(C)(C)C)c2nnn(CCO)n2)cc1 |
| InChI | InChI=1S/C17H25N5O4/c1-17(2,3)26-16(24)18-14(15-19-21-22(20-15)9-10-23)11-12-5-7-13(25-4)8-6-12/h5-8,14,23H,9-11H2,1-4H3,(H,18,24) |
| InChIKey | NWGOKBXNYNPXAL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |