C12H14ClN5O3 — CID 135239060
[(1S)-2-(4-chlorophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamic acid (PubChem CID 135239060) has the molecular formula C12H14ClN5O3 and a molecular weight of 311.73 g/mol. Its IUPAC name is [(1S)-2-(4-chlorophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamic acid.
| Compound Name | [(1S)-2-(4-chlorophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 135239060 |
| Molecular Formula | C12H14ClN5O3 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [(1S)-2-(4-chlorophenyl)-1-[2-(2-hydroxyethyl)tetrazol-5-yl]ethyl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccc(Cl)cc1)c1nnn(CCO)n1 |
| InChI | InChI=1S/C12H14ClN5O3/c13-9-3-1-8(2-4-9)7-10(14-12(20)21)11-15-17-18(16-11)5-6-19/h1-4,10,14,19H,5-7H2,(H,20,21)/t10-/m0/s1 |
| InChIKey | RZFPBWDRXJFEQF-JTQLQIEISA-N |
| XLogP | 0.87 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |