C14H19N5O5S — CID 135238859
[2-(4-methoxyphenyl)-1-[2-(2-methylsulfonylethyl)tetrazol-5-yl]ethyl]carbamic acid (PubChem CID 135238859) has the molecular formula C14H19N5O5S and a molecular weight of 369.40 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1-[2-(2-methylsulfonylethyl)tetrazol-5-yl]ethyl]carbamic acid.
| Compound Name | [2-(4-methoxyphenyl)-1-[2-(2-methylsulfonylethyl)tetrazol-5-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 135238859 |
| Molecular Formula | C14H19N5O5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-(4-methoxyphenyl)-1-[2-(2-methylsulfonylethyl)tetrazol-5-yl]ethyl]carbamic acid |
| SMILES | COc1ccc(CC(NC(=O)O)c2nnn(CCS(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C14H19N5O5S/c1-24-11-5-3-10(4-6-11)9-12(15-14(20)21)13-16-18-19(17-13)7-8-25(2,22)23/h3-6,12,15H,7-9H2,1-2H3,(H,20,21) |
| InChIKey | HIGYSACMQPRHPU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |