C19H27N3O4 — CID 135255185
tert-butyl N-[(1S)-1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(4-methoxyphenyl)ethyl]carbamate (PubChem CID 135255185) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(4-methoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(4-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 135255185 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl N-[(1S)-1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(4-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1ccc(C[C@H](NC(=O)OC(C)(C)C)c2ccn(CCO)n2)cc1 |
| InChI | InChI=1S/C19H27N3O4/c1-19(2,3)26-18(24)20-17(16-9-10-22(21-16)11-12-23)13-14-5-7-15(25-4)8-6-14/h5-10,17,23H,11-13H2,1-4H3,(H,20,24)/t17-/m0/s1 |
| InChIKey | VJVBZFTUXJMXIP-KRWDZBQOSA-N |
| XLogP | 2.69 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |