C21H25F2N3O3 — CID 162598244
2,2-difluoro-N-[3-oxo-2-[4-(3-oxopropyl)cyclohexyl]-1H-isoindole-5-carboximidoyl]propanamide (PubChem CID 162598244) has the molecular formula C21H25F2N3O3 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-oxo-2-[4-(3-oxopropyl)cyclohexyl]-1H-isoindole-5-carboximidoyl]propanamide.
| Compound Name | 2,2-difluoro-N-[3-oxo-2-[4-(3-oxopropyl)cyclohexyl]-1H-isoindole-5-carboximidoyl]propanamide |
|---|---|
| PubChem CID | 162598244 |
| Molecular Formula | C21H25F2N3O3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2,2-difluoro-N-[3-oxo-2-[4-(3-oxopropyl)cyclohexyl]-1H-isoindole-5-carboximidoyl]propanamide |
| SMILES | [H]/N=C(\NC(=O)C(C)(F)F)c1ccc2c(c1)C(=O)N(C1CCC(CCC=O)CC1)C2 |
| InChI | InChI=1S/C21H25F2N3O3/c1-21(22,23)20(29)25-18(24)14-6-7-15-12-26(19(28)17(15)11-14)16-8-4-13(5-9-16)3-2-10-27/h6-7,10-11,13,16H,2-5,8-9,12H2,1H3,(H2,24,25,29) |
| InChIKey | MQCNAPFBTCKLRS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|