C19H21F3N4O4S — CID 162598410
4-[[[(1,1-dioxo-1,4-thiazinan-4-yl)-hydroxymethyl]-[6-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzamide (PubChem CID 162598410) has the molecular formula C19H21F3N4O4S and a molecular weight of 458.46 g/mol. Its IUPAC name is 4-[[[(1,1-dioxo-1,4-thiazinan-4-yl)-hydroxymethyl]-[6-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzamide.
| Compound Name | 4-[[[(1,1-dioxo-1,4-thiazinan-4-yl)-hydroxymethyl]-[6-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 162598410 |
| Molecular Formula | C19H21F3N4O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-[[[(1,1-dioxo-1,4-thiazinan-4-yl)-hydroxymethyl]-[6-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN(c2cccc(C(F)(F)F)n2)C(O)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C19H21F3N4O4S/c20-19(21,22)15-2-1-3-16(24-15)26(12-13-4-6-14(7-5-13)17(23)27)18(28)25-8-10-31(29,30)11-9-25/h1-7,18,28H,8-12H2,(H2,23,27) |
| InChIKey | NCRPSIRBIGPXDC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|