C18H22BrF3N2O2 — CID 162599452
tert-butyl (4aS,9bR)-8-bromo-4a-methyl-6-(trifluoromethyl)-3,4,5,9b-tetrahydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 162599452) has the molecular formula C18H22BrF3N2O2 and a molecular weight of 435.28 g/mol. Its IUPAC name is tert-butyl (4aS,9bR)-8-bromo-4a-methyl-6-(trifluoromethyl)-3,4,5,9b-tetrahydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl (4aS,9bR)-8-bromo-4a-methyl-6-(trifluoromethyl)-3,4,5,9b-tetrahydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 162599452 |
| Molecular Formula | C18H22BrF3N2O2 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | tert-butyl (4aS,9bR)-8-bromo-4a-methyl-6-(trifluoromethyl)-3,4,5,9b-tetrahydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@]2(C)Nc3c(cc(Br)cc3C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C18H22BrF3N2O2/c1-16(2,3)26-15(25)24-6-5-17(4)13(9-24)11-7-10(19)8-12(14(11)23-17)18(20,21)22/h7-8,13,23H,5-6,9H2,1-4H3/t13-,17-/m0/s1 |
| InChIKey | OCIKNDQJYRVTQM-GUYCJALGSA-N |
| XLogP | 5.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |