C17H20BrN3O2 — CID 67180953
tert-butyl (4aR,9bS)-8-bromo-6-cyano-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 67180953) has the molecular formula C17H20BrN3O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is tert-butyl (4aR,9bS)-8-bromo-6-cyano-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl (4aR,9bS)-8-bromo-6-cyano-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67180953 |
| Molecular Formula | C17H20BrN3O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | tert-butyl (4aR,9bS)-8-bromo-6-cyano-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2Nc3c(C#N)cc(Br)cc3[C@H]2C1 |
| InChI | InChI=1S/C17H20BrN3O2/c1-17(2,3)23-16(22)21-5-4-14-13(9-21)12-7-11(18)6-10(8-19)15(12)20-14/h6-7,13-14,20H,4-5,9H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | SIJSOCQSBNOICP-ZIAGYGMSSA-N |
| XLogP | 3.84 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |