C17H23BrN2O2S — CID 21056723
tert-butyl (4aR,9bS)-8-bromo-6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 21056723) has the molecular formula C17H23BrN2O2S and a molecular weight of 399.35 g/mol. Its IUPAC name is tert-butyl (4aR,9bS)-8-bromo-6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl (4aR,9bS)-8-bromo-6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 21056723 |
| Molecular Formula | C17H23BrN2O2S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | tert-butyl (4aR,9bS)-8-bromo-6-methylsulfanyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | CSc1cc(Br)cc2c1N[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]21 |
| InChI | InChI=1S/C17H23BrN2O2S/c1-17(2,3)22-16(21)20-6-5-13-12(9-20)11-7-10(18)8-14(23-4)15(11)19-13/h7-8,12-13,19H,5-6,9H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | JSRYOVQGALDRDQ-CHWSQXEVSA-N |
| XLogP | 4.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |