C30H30F6N2O2 — CID 162599704
N-(2-phenylethyl)-3-[3-[4-(trifluoromethyl)phenoxy]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxiran-2-amine (PubChem CID 162599704) has the molecular formula C30H30F6N2O2 and a molecular weight of 564.57 g/mol. Its IUPAC name is N-(2-phenylethyl)-3-[3-[4-(trifluoromethyl)phenoxy]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxiran-2-amine.
| Compound Name | N-(2-phenylethyl)-3-[3-[4-(trifluoromethyl)phenoxy]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxiran-2-amine |
|---|---|
| PubChem CID | 162599704 |
| Molecular Formula | C30H30F6N2O2 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | N-(2-phenylethyl)-3-[3-[4-(trifluoromethyl)phenoxy]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxiran-2-amine |
| SMILES | FC(F)(F)c1ccc(OC2(C3OC3NCCc3ccccc3)CCCN(Cc3cccc(C(F)(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C30H30F6N2O2/c31-29(32,33)23-10-12-25(13-11-23)40-28(26-27(39-26)37-16-14-21-6-2-1-3-7-21)15-5-17-38(20-28)19-22-8-4-9-24(18-22)30(34,35)36/h1-4,6-13,18,26-27,37H,5,14-17,19-20H2 |
| InChIKey | BQYBARWCZQQZET-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|