C24H22F3NO2 — CID 66653794
4-benzyl-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]morpholine (PubChem CID 66653794) has the molecular formula C24H22F3NO2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 4-benzyl-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]morpholine.
| Compound Name | 4-benzyl-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]morpholine |
|---|---|
| PubChem CID | 66653794 |
| Molecular Formula | C24H22F3NO2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-benzyl-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]morpholine |
| SMILES | FC(F)(F)c1cccc(Oc2ccc(C3CN(Cc4ccccc4)CCO3)cc2)c1 |
| InChI | InChI=1S/C24H22F3NO2/c25-24(26,27)20-7-4-8-22(15-20)30-21-11-9-19(10-12-21)23-17-28(13-14-29-23)16-18-5-2-1-3-6-18/h1-12,15,23H,13-14,16-17H2 |
| InChIKey | PRVFDBCNQHEPHK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |