C20H20F3N3O — CID 178059966
(2R)-2-(3-methylbenzimidazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 178059966) has the molecular formula C20H20F3N3O and a molecular weight of 375.39 g/mol. Its IUPAC name is (2R)-2-(3-methylbenzimidazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | (2R)-2-(3-methylbenzimidazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 178059966 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (2R)-2-(3-methylbenzimidazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | Cn1cnc2ccc([C@@H]3CN(Cc4cccc(C(F)(F)F)c4)CCO3)cc21 |
| InChI | InChI=1S/C20H20F3N3O/c1-25-13-24-17-6-5-15(10-18(17)25)19-12-26(7-8-27-19)11-14-3-2-4-16(9-14)20(21,22)23/h2-6,9-10,13,19H,7-8,11-12H2,1H3/t19-/m0/s1 |
| InChIKey | HJHUIXXEYDGDEN-IBGZPJMESA-N |
| XLogP | 4.17 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |