C19H19F3N4O — CID 178060063
2-(3-methylbenzimidazol-5-yl)-4-[[4-(trifluoromethyl)-2-pyridinyl]methyl]morpholine (PubChem CID 178060063) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-(3-methylbenzimidazol-5-yl)-4-[[4-(trifluoromethyl)-2-pyridinyl]methyl]morpholine.
| Compound Name | 2-(3-methylbenzimidazol-5-yl)-4-[[4-(trifluoromethyl)-2-pyridinyl]methyl]morpholine |
|---|---|
| PubChem CID | 178060063 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(3-methylbenzimidazol-5-yl)-4-[[4-(trifluoromethyl)-2-pyridinyl]methyl]morpholine |
| SMILES | Cn1cnc2ccc(C3CN(Cc4cc(C(F)(F)F)ccn4)CCO3)cc21 |
| InChI | InChI=1S/C19H19F3N4O/c1-25-12-24-16-3-2-13(8-17(16)25)18-11-26(6-7-27-18)10-15-9-14(4-5-23-15)19(20,21)22/h2-5,8-9,12,18H,6-7,10-11H2,1H3 |
| InChIKey | WMZQZJOBNKDDDN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |