C21H22F3N3O2 — CID 178059903
4-[[3-methoxy-5-(trifluoromethyl)phenyl]methyl]-2-(3-methylbenzimidazol-5-yl)morpholine (PubChem CID 178059903) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-[[3-methoxy-5-(trifluoromethyl)phenyl]methyl]-2-(3-methylbenzimidazol-5-yl)morpholine.
| Compound Name | 4-[[3-methoxy-5-(trifluoromethyl)phenyl]methyl]-2-(3-methylbenzimidazol-5-yl)morpholine |
|---|---|
| PubChem CID | 178059903 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[[3-methoxy-5-(trifluoromethyl)phenyl]methyl]-2-(3-methylbenzimidazol-5-yl)morpholine |
| SMILES | COc1cc(CN2CCOC(c3ccc4ncn(C)c4c3)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-26-13-25-18-4-3-15(9-19(18)26)20-12-27(5-6-29-20)11-14-7-16(21(22,23)24)10-17(8-14)28-2/h3-4,7-10,13,20H,5-6,11-12H2,1-2H3 |
| InChIKey | XZZUNRQBOGWJGV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |