C24H31F3N6O2 — CID 162601101
N'-[N'-(1-ethoxyethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 162601101) has the molecular formula C24H31F3N6O2 and a molecular weight of 492.55 g/mol. Its IUPAC name is N'-[N'-(1-ethoxyethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[N'-(1-ethoxyethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 162601101 |
| Molecular Formula | C24H31F3N6O2 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | N'-[N'-(1-ethoxyethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCOC(C)N=C(N=C(N)N1CCN(c2ccccc2OC)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H31F3N6O2/c1-4-35-17(2)29-23(30-19-9-7-8-18(16-19)24(25,26)27)31-22(28)33-14-12-32(13-15-33)20-10-5-6-11-21(20)34-3/h5-11,16-17H,4,12-15H2,1-3H3,(H3,28,29,30,31) |
| InChIKey | HVOVGOMAAVXAHA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|