C6H8F3N3O2 — CID 162602783
1-amino-2-hydroxy-3-methyl-6-(trifluoromethyl)-2H-pyrimidin-4-one (PubChem CID 162602783) has the molecular formula C6H8F3N3O2 and a molecular weight of 211.14 g/mol. Its IUPAC name is 1-amino-2-hydroxy-3-methyl-6-(trifluoromethyl)-2H-pyrimidin-4-one.
| Compound Name | 1-amino-2-hydroxy-3-methyl-6-(trifluoromethyl)-2H-pyrimidin-4-one |
|---|---|
| PubChem CID | 162602783 |
| Molecular Formula | C6H8F3N3O2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 1-amino-2-hydroxy-3-methyl-6-(trifluoromethyl)-2H-pyrimidin-4-one |
| SMILES | CN1C(=O)C=C(C(F)(F)F)N(N)C1O |
| InChI | InChI=1S/C6H8F3N3O2/c1-11-4(13)2-3(6(7,8)9)12(10)5(11)14/h2,5,14H,10H2,1H3 |
| InChIKey | ISVSREAZOVCNQY-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|