C5H9N3O2 — CID 149206156
3-hydroxy-2,4-dimethyl-3H-1,2,4-triazin-5-one (PubChem CID 149206156) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is 3-hydroxy-2,4-dimethyl-3H-1,2,4-triazin-5-one.
| Compound Name | 3-hydroxy-2,4-dimethyl-3H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 149206156 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 3-hydroxy-2,4-dimethyl-3H-1,2,4-triazin-5-one |
| SMILES | CN1N=CC(=O)N(C)C1O |
| InChI | InChI=1S/C5H9N3O2/c1-7-4(9)3-6-8(2)5(7)10/h3,5,10H,1-2H3 |
| InChIKey | XFQNOCYGFYBARM-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |