C7H9N5O2 — CID 129144078
2-amino-8-methyl-4a,8a-dihydro-3H-pteridine-4,7-dione (PubChem CID 129144078) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-amino-8-methyl-4a,8a-dihydro-3H-pteridine-4,7-dione.
| Compound Name | 2-amino-8-methyl-4a,8a-dihydro-3H-pteridine-4,7-dione |
|---|---|
| PubChem CID | 129144078 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-amino-8-methyl-4a,8a-dihydro-3H-pteridine-4,7-dione |
| SMILES | CN1C(=O)C=NC2C(=O)NC(N)=NC21 |
| InChI | InChI=1S/C7H9N5O2/c1-12-3(13)2-9-4-5(12)10-7(8)11-6(4)14/h2,4-5H,1H3,(H3,8,10,11,14) |
| InChIKey | IYMIGUYIVNINTD-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |