C8H13N5O3 — CID 2784002
2-amino-9-(2-hydroxyethoxymethyl)-4,5-dihydro-1H-purin-6-one (PubChem CID 2784002) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-4,5-dihydro-1H-purin-6-one.
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-4,5-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 2784002 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-4,5-dihydro-1H-purin-6-one |
| SMILES | NC1=NC2C(N=CN2COCCO)C(=O)N1 |
| InChI | InChI=1S/C8H13N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,5-6,14H,1-2,4H2,(H3,9,11,12,15) |
| InChIKey | NUOLWRYRDZGNKO-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|