C16H29N5O4Si — CID 174003568
2-amino-9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4,5-dihydro-1H-purin-6-one (PubChem CID 174003568) has the molecular formula C16H29N5O4Si and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-amino-9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4,5-dihydro-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4,5-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 174003568 |
| Molecular Formula | C16H29N5O4Si |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-amino-9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-4,5-dihydro-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3C(=O)NC(N)=NC32)C[C@H]1O |
| InChI | InChI=1S/C16H29N5O4Si/c1-16(2,3)26(4,5)24-7-10-9(22)6-11(25-10)21-8-18-12-13(21)19-15(17)20-14(12)23/h8-13,22H,6-7H2,1-5H3,(H3,17,19,20,23)/t9-,10-,11-,12?,13?/m1/s1 |
| InChIKey | ZLTUXGVTAFRSTI-OTQSUOKKSA-N |
| XLogP | -0.03 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|