C38H31ClF4N2O5S — CID 162603426
methyl 3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[[2-[(ethylidene-oxo-phenyl-λ6-sulfanyl)-hydroxyamino]-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate (PubChem CID 162603426) has the molecular formula C38H31ClF4N2O5S and a molecular weight of 739.19 g/mol. Its IUPAC name is methyl 3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[[2-[(ethylidene-oxo-phenyl-λ6-sulfanyl)-hydroxyamino]-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[[2-[(ethylidene-oxo-phenyl-λ6-sulfanyl)-hydroxyamino]-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 162603426 |
| Molecular Formula | C38H31ClF4N2O5S |
| Molecular Weight | 739.19 g/mol |
| Exact Mass | 738.16 |
| IUPAC Name | methyl 3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[[2-[(ethylidene-oxo-phenyl-λ6-sulfanyl)-hydroxyamino]-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate |
| SMILES | CC=S(=O)(c1ccccc1)N(O)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1C(=O)NC(Cc1ccc(-c2ccc(F)c(Cl)c2)cc1)C(=O)OC |
| InChI | InChI=1S/C38H31ClF4N2O5S/c1-3-51(49,30-7-5-4-6-8-30)45(48)35-20-16-27(26-13-17-29(18-14-26)38(41,42)43)22-31(35)36(46)44-34(37(47)50-2)21-24-9-11-25(12-10-24)28-15-19-33(40)32(39)23-28/h3-20,22-23,34,48H,21H2,1-2H3,(H,44,46) |
| InChIKey | GQVSLYCLOYRLJZ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.19 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|