C34H28ClF4NO4 — CID 69206359
ethyl 5-[4-(3-chloro-4-fluorophenyl)phenyl]-4-[[2-methoxy-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]pent-2-enoate (PubChem CID 69206359) has the molecular formula C34H28ClF4NO4 and a molecular weight of 626.05 g/mol. Its IUPAC name is ethyl 5-[4-(3-chloro-4-fluorophenyl)phenyl]-4-[[2-methoxy-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]pent-2-enoate.
| Compound Name | ethyl 5-[4-(3-chloro-4-fluorophenyl)phenyl]-4-[[2-methoxy-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 69206359 |
| Molecular Formula | C34H28ClF4NO4 |
| Molecular Weight | 626.05 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | ethyl 5-[4-(3-chloro-4-fluorophenyl)phenyl]-4-[[2-methoxy-5-[4-(trifluoromethyl)phenyl]benzoyl]amino]pent-2-enoate |
| SMILES | CCOC(=O)C=CC(Cc1ccc(-c2ccc(F)c(Cl)c2)cc1)NC(=O)c1cc(-c2ccc(C(F)(F)F)cc2)ccc1OC |
| InChI | InChI=1S/C34H28ClF4NO4/c1-3-44-32(41)17-14-27(18-21-4-6-22(7-5-21)25-10-15-30(36)29(35)20-25)40-33(42)28-19-24(11-16-31(28)43-2)23-8-12-26(13-9-23)34(37,38)39/h4-17,19-20,27H,3,18H2,1-2H3,(H,40,42) |
| InChIKey | WNACBBVNUKOUKT-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.05 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|