C33H26F2N3O5PS — CID 162603716
[[4-[[[4-(3-cyanophenyl)phenyl]methyl-naphthalen-2-ylsulfonylamino]methyl]-2-(methylideneamino)phenyl]-difluoromethyl]phosphonic acid (PubChem CID 162603716) has the molecular formula C33H26F2N3O5PS and a molecular weight of 645.62 g/mol. Its IUPAC name is [[4-[[[4-(3-cyanophenyl)phenyl]methyl-naphthalen-2-ylsulfonylamino]methyl]-2-(methylideneamino)phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[[[4-(3-cyanophenyl)phenyl]methyl-naphthalen-2-ylsulfonylamino]methyl]-2-(methylideneamino)phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 162603716 |
| Molecular Formula | C33H26F2N3O5PS |
| Molecular Weight | 645.62 g/mol |
| Exact Mass | 645.13 |
| IUPAC Name | [[4-[[[4-(3-cyanophenyl)phenyl]methyl-naphthalen-2-ylsulfonylamino]methyl]-2-(methylideneamino)phenyl]-difluoromethyl]phosphonic acid |
| SMILES | C=Nc1cc(CN(Cc2ccc(-c3cccc(C#N)c3)cc2)S(=O)(=O)c2ccc3ccccc3c2)ccc1C(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C33H26F2N3O5PS/c1-37-32-18-25(11-16-31(32)33(34,35)44(39,40)41)22-38(45(42,43)30-15-14-26-6-2-3-7-29(26)19-30)21-23-9-12-27(13-10-23)28-8-4-5-24(17-28)20-36/h2-19H,1,21-22H2,(H2,39,40,41) |
| InChIKey | UGALJPDXXCKQPZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.62 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|