C32H32F3N5O3S — CID 162604894
N-[3-[(E)-2-[2-[4-[4-(ethylamino)butan-2-ylsulfonyl]anilino]pyrimidin-5-yl]ethenyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 162604894) has the molecular formula C32H32F3N5O3S and a molecular weight of 623.70 g/mol. Its IUPAC name is N-[3-[(E)-2-[2-[4-[4-(ethylamino)butan-2-ylsulfonyl]anilino]pyrimidin-5-yl]ethenyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(E)-2-[2-[4-[4-(ethylamino)butan-2-ylsulfonyl]anilino]pyrimidin-5-yl]ethenyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162604894 |
| Molecular Formula | C32H32F3N5O3S |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | N-[3-[(E)-2-[2-[4-[4-(ethylamino)butan-2-ylsulfonyl]anilino]pyrimidin-5-yl]ethenyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCNCCC(C)S(=O)(=O)c1ccc(Nc2ncc(/C=C/c3cccc(NC(=O)c4cccc(C(F)(F)F)c4)c3)cn2)cc1 |
| InChI | InChI=1S/C32H32F3N5O3S/c1-3-36-17-16-22(2)44(42,43)29-14-12-27(13-15-29)40-31-37-20-24(21-38-31)11-10-23-6-4-9-28(18-23)39-30(41)25-7-5-8-26(19-25)32(33,34)35/h4-15,18-22,36H,3,16-17H2,1-2H3,(H,39,41)(H,37,38,40)/b11-10+ |
| InChIKey | JHNQPRNXAUCENQ-ZHACJKMWSA-N |
| XLogP | 6.82 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|